C25H27N7O3 — CID 134460208
2-(6-aminopurin-9-yl)-5-[[2-(1-methylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol (PubChem CID 134460208) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-[[2-(1-methylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-[[2-(1-methylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 134460208 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-[[2-(1-methylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol |
| SMILES | Cc1cccc2c3ccccc3n(CCNCC3OC(n4cnc5c(N)ncnc54)C(O)C3O)c12 |
| InChI | InChI=1S/C25H27N7O3/c1-14-5-4-7-16-15-6-2-3-8-17(15)31(20(14)16)10-9-27-11-18-21(33)22(34)25(35-18)32-13-30-19-23(26)28-12-29-24(19)32/h2-8,12-13,18,21-22,25,27,33-34H,9-11H2,1H3,(H2,26,28,29) |
| InChIKey | YUXYGYAZAFVTHZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|