C13H18N6O4 — CID 70504483
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(3-hydroxyprop-2-enylamino)methyl]oxolane-3,4-diol (PubChem CID 70504483) has the molecular formula C13H18N6O4 and a molecular weight of 322.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(3-hydroxyprop-2-enylamino)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(3-hydroxyprop-2-enylamino)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70504483 |
| Molecular Formula | C13H18N6O4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(3-hydroxyprop-2-enylamino)methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNCC=CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18N6O4/c14-11-8-12(17-5-16-11)19(6-18-8)13-10(22)9(21)7(23-13)4-15-2-1-3-20/h1,3,5-7,9-10,13,15,20-22H,2,4H2,(H2,14,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | GORTWPPQOFFGHR-QYVSTXNMSA-N |
| XLogP | -1.31 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|