C15H21N7O5 — CID 67763217
(Z)-2-amino-5-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]pent-3-enoic acid (PubChem CID 67763217) has the molecular formula C15H21N7O5 and a molecular weight of 379.38 g/mol. Its IUPAC name is (Z)-2-amino-5-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]pent-3-enoic acid.
| Compound Name | (Z)-2-amino-5-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]pent-3-enoic acid |
|---|---|
| PubChem CID | 67763217 |
| Molecular Formula | C15H21N7O5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (Z)-2-amino-5-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]pent-3-enoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNC/C=C\C(N)C(=O)O)C(O)C1O |
| InChI | InChI=1S/C15H21N7O5/c16-7(15(25)26)2-1-3-18-4-8-10(23)11(24)14(27-8)22-6-21-9-12(17)19-5-20-13(9)22/h1-2,5-8,10-11,14,18,23-24H,3-4,16H2,(H,25,26)(H2,17,19,20)/b2-1-/t7?,8-,10?,11?,14-/m1/s1 |
| InChIKey | GPNBYWWWKHLWFV-BOHSECQESA-N |
| XLogP | -2.41 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|