C15H19N7O4 — CID 46902122
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]oxolane-3,4-diol (PubChem CID 46902122) has the molecular formula C15H19N7O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46902122 |
| Molecular Formula | C15H19N7O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]oxolane-3,4-diol |
| SMILES | Cc1cc(CNC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)no1 |
| InChI | InChI=1S/C15H19N7O4/c1-7-2-8(21-26-7)3-17-4-9-11(23)12(24)15(25-9)22-6-20-10-13(16)18-5-19-14(10)22/h2,5-6,9,11-12,15,17,23-24H,3-4H2,1H3,(H2,16,18,19)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | SKRPYPCJRFCLLG-SDBHATRESA-N |
| XLogP | -0.89 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |