C20H23N7O3 — CID 159920700
2-[[2-(benzimidazol-1-yl)ethylamino]methyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol (PubChem CID 159920700) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-[[2-(benzimidazol-1-yl)ethylamino]methyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-[[2-(benzimidazol-1-yl)ethylamino]methyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 159920700 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[[2-(benzimidazol-1-yl)ethylamino]methyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ncn2C1OC(CNCCn2cnc3ccccc32)C(O)C1O |
| InChI | InChI=1S/C20H23N7O3/c1-12-16-19(23-9-22-12)27(11-25-16)20-18(29)17(28)15(30-20)8-21-6-7-26-10-24-13-4-2-3-5-14(13)26/h2-5,9-11,15,17-18,20-21,28-29H,6-8H2,1H3 |
| InChIKey | PWBRKEHTDVARBY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|