C23H21N7O3 — CID 58996867
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(2-phenylbenzimidazol-1-yl)methyl]oxolane-3,4-diol (PubChem CID 58996867) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(2-phenylbenzimidazol-1-yl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(2-phenylbenzimidazol-1-yl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 58996867 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(2-phenylbenzimidazol-1-yl)methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](Cn2c(-c3ccccc3)nc3ccccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H21N7O3/c24-20-17-22(26-11-25-20)30(12-27-17)23-19(32)18(31)16(33-23)10-29-15-9-5-4-8-14(15)28-21(29)13-6-2-1-3-7-13/h1-9,11-12,16,18-19,23,31-32H,10H2,(H2,24,25,26)/t16-,18-,19-,23-/m1/s1 |
| InChIKey | POBZXEOXGTYGRS-DYVMYPEFSA-N |
| XLogP | 1.74 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |