C26H29N7O3 — CID 139447935
4-(6-aminopurin-9-yl)-2-[[2-(2,5-dimethylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol (PubChem CID 139447935) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-[[2-(2,5-dimethylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-[[2-(2,5-dimethylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139447935 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-[[2-(2,5-dimethylcarbazol-9-yl)ethylamino]methyl]oxolane-3,4-diol |
| SMILES | Cc1ccc2c3c(C)cccc3n(CCNCC3OCC(O)(n4cnc5c(N)ncnc54)C3O)c2c1 |
| InChI | InChI=1S/C26H29N7O3/c1-15-6-7-17-19(10-15)32(18-5-3-4-16(2)21(17)18)9-8-28-11-20-23(34)26(35,12-36-20)33-14-31-22-24(27)29-13-30-25(22)33/h3-7,10,13-14,20,23,28,34-35H,8-9,11-12H2,1-2H3,(H2,27,29,30) |
| InChIKey | VJHVCEJGXBLUAH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|