C34H35N5O4 — CID 11006354
9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-[(2R)-1-phenylpropan-2-yl]purin-6-amine (PubChem CID 11006354) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-[(2R)-1-phenylpropan-2-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-[(2R)-1-phenylpropan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 11006354 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-[(2R)-1-phenylpropan-2-yl]purin-6-amine |
| SMILES | C[C@H](Cc1ccccc1)Nc1ncnc2c1ncn2[C@]1(C)O[C@H](COCc2ccccc2)[C@H]2OC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C34H35N5O4/c1-23(18-24-12-6-3-7-13-24)38-31-28-32(36-21-35-31)39(22-37-28)34(2)30-29(41-33(42-30)26-16-10-5-11-17-26)27(43-34)20-40-19-25-14-8-4-9-15-25/h3-17,21-23,27,29-30,33H,18-20H2,1-2H3,(H,35,36,38)/t23-,27-,29-,30-,33?,34-/m1/s1 |
| InChIKey | BEOUZFJLHJNTKN-KWKDQVTFSA-N |
| XLogP | 5.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |