C43H42ClN5O5Si — CID 87733230
[(2R,3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(6-chloropurin-9-yl)-4-[[2-(9H-fluoren-1-yl)acetyl]amino]oxolan-3-yl] acetate (PubChem CID 87733230) has the molecular formula C43H42ClN5O5Si and a molecular weight of 772.38 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(6-chloropurin-9-yl)-4-[[2-(9H-fluoren-1-yl)acetyl]amino]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(6-chloropurin-9-yl)-4-[[2-(9H-fluoren-1-yl)acetyl]amino]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 87733230 |
| Molecular Formula | C43H42ClN5O5Si |
| Molecular Weight | 772.38 g/mol |
| Exact Mass | 771.26 |
| IUPAC Name | [(2R,3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(6-chloropurin-9-yl)-4-[[2-(9H-fluoren-1-yl)acetyl]amino]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](NC(=O)Cc2cccc3c2Cc2ccccc2-3)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C43H42ClN5O5Si/c1-27(50)53-39-37(48-36(51)23-29-15-13-21-33-32-20-12-11-14-28(32)22-34(29)33)35(54-42(39)49-26-47-38-40(44)45-25-46-41(38)49)24-52-55(43(2,3)4,30-16-7-5-8-17-30)31-18-9-6-10-19-31/h5-21,25-26,35,37,39,42H,22-24H2,1-4H3,(H,48,51)/t35-,37-,39-,42-/m1/s1 |
| InChIKey | BQRILBASVBNNSQ-XXEKRNSPSA-N |
| XLogP | 6.18 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.38 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|