C31H35ClIN3O3SSi — CID 153401744
[(3aS,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 153401744) has the molecular formula C31H35ClIN3O3SSi and a molecular weight of 720.15 g/mol. Its IUPAC name is [(3aS,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 153401744 |
| Molecular Formula | C31H35ClIN3O3SSi |
| Molecular Weight | 720.15 g/mol |
| Exact Mass | 719.09 |
| IUPAC Name | [(3aS,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](n3ccc4c(Cl)ncnc43)SC(CI)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C31H35ClIN3O3SSi/c1-29(2,3)41(21-12-8-6-9-13-21,22-14-10-7-11-15-22)37-19-31(18-33)25-24(38-30(4,5)39-25)28(40-31)36-17-16-23-26(32)34-20-35-27(23)36/h6-17,20,24-25,28H,18-19H2,1-5H3/t24-,25+,28-,31?/m1/s1 |
| InChIKey | YQHPAKVEXQFAGT-ANGWLLSZSA-N |
| XLogP | 6.60 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.15 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|