C38H43N3O4Si — CID 156705305
[(3aR,4S,6R,6aS)-2,2,4-trimethyl-6-(4-phenoxypyrrolo[2,3-d]pyrimidin-7-yl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 156705305) has the molecular formula C38H43N3O4Si and a molecular weight of 633.87 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-2,2,4-trimethyl-6-(4-phenoxypyrrolo[2,3-d]pyrimidin-7-yl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4S,6R,6aS)-2,2,4-trimethyl-6-(4-phenoxypyrrolo[2,3-d]pyrimidin-7-yl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 156705305 |
| Molecular Formula | C38H43N3O4Si |
| Molecular Weight | 633.87 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | [(3aR,4S,6R,6aS)-2,2,4-trimethyl-6-(4-phenoxypyrrolo[2,3-d]pyrimidin-7-yl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](n3ccc4c(Oc5ccccc5)ncnc43)C[C@@](C)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C38H43N3O4Si/c1-36(2,3)46(28-18-12-8-13-19-28,29-20-14-9-15-21-29)42-25-38(6)24-31(32-33(38)45-37(4,5)44-32)41-23-22-30-34(41)39-26-40-35(30)43-27-16-10-7-11-17-27/h7-23,26,31-33H,24-25H2,1-6H3/t31-,32+,33+,38+/m1/s1 |
| InChIKey | LKBDDYLVDQTUGY-UDVDJYOYSA-N |
| XLogP | 7.27 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|