C30H37N3O5Si — CID 162704189
methyl 1-[(1R,2R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-1,2,4-triazole-3-carboxylate (PubChem CID 162704189) has the molecular formula C30H37N3O5Si and a molecular weight of 547.73 g/mol. Its IUPAC name is methyl 1-[(1R,2R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(1R,2R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 162704189 |
| Molecular Formula | C30H37N3O5Si |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | methyl 1-[(1R,2R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn([C@H]2[C@@H]3OC(C)(C)O[C@@H]3[C@]3(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C[C@H]23)n1 |
| InChI | InChI=1S/C30H37N3O5Si/c1-28(2,3)39(20-13-9-7-10-14-20,21-15-11-8-12-16-21)36-18-30-17-22(30)23(24-25(30)38-29(4,5)37-24)33-19-31-26(32-33)27(34)35-6/h7-16,19,22-25H,17-18H2,1-6H3/t22-,23-,24+,25+,30+/m1/s1 |
| InChIKey | QBGHCLOEAKFCJM-FZDWJYANSA-N |
| XLogP | 3.72 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|