C32H36ClN3O3Si — CID 155738646
[(3aR,6R,6aS)-6-(4-chloro-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 155738646) has the molecular formula C32H36ClN3O3Si and a molecular weight of 574.20 g/mol. Its IUPAC name is [(3aR,6R,6aS)-6-(4-chloro-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,6R,6aS)-6-(4-chloro-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 155738646 |
| Molecular Formula | C32H36ClN3O3Si |
| Molecular Weight | 574.20 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | [(3aR,6R,6aS)-6-(4-chloro-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | Cc1cn([C@@H]2C=C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)c2ncnc(Cl)c12 |
| InChI | InChI=1S/C32H36ClN3O3Si/c1-21-18-36(30-26(21)29(33)34-20-35-30)25-17-22(27-28(25)39-32(5,6)38-27)19-37-40(31(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-18,20,25,27-28H,19H2,1-6H3/t25-,27-,28+/m1/s1 |
| InChIKey | DMQJXQMAZKBIBA-KZQOYIJHSA-N |
| XLogP | 5.97 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.20 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|