C34H40N4O3SSi — CID 172691614
7-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-5-but-1-ynylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 172691614) has the molecular formula C34H40N4O3SSi and a molecular weight of 612.87 g/mol. Its IUPAC name is 7-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-5-but-1-ynylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-5-but-1-ynylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172691614 |
| Molecular Formula | C34H40N4O3SSi |
| Molecular Weight | 612.87 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 7-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-5-but-1-ynylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC#Cc1cn([C@@H]2S[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)c2ncnc(N)c12 |
| InChI | InChI=1S/C34H40N4O3SSi/c1-7-8-15-23-20-38(31-27(23)30(35)36-22-37-31)32-29-28(40-34(5,6)41-29)26(42-32)21-39-43(33(2,3)4,24-16-11-9-12-17-24)25-18-13-10-14-19-25/h9-14,16-20,22,26,28-29,32H,7,21H2,1-6H3,(H2,35,36,37)/t26-,28-,29-,32-/m1/s1 |
| InChIKey | BTGJAWNWALCMFX-DWCTZGTLSA-N |
| XLogP | 5.49 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.87 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|