C16H26ClN5O2Si — CID 11101039
9-[(2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-chloropurin-6-amine (PubChem CID 11101039) has the molecular formula C16H26ClN5O2Si and a molecular weight of 383.96 g/mol. Its IUPAC name is 9-[(2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-chloropurin-6-amine.
| Compound Name | 9-[(2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-chloropurin-6-amine |
|---|---|
| PubChem CID | 11101039 |
| Molecular Formula | C16H26ClN5O2Si |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 9-[(2S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-chloropurin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC[C@@H](n2cnc3c(N)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C16H26ClN5O2Si/c1-16(2,3)25(4,5)23-8-10-6-7-11(24-10)22-9-19-12-13(18)20-15(17)21-14(12)22/h9-11H,6-8H2,1-5H3,(H2,18,20,21)/t10-,11-/m0/s1 |
| InChIKey | GCPKPQDEEJCEFD-QWRGUYRKSA-N |
| XLogP | 3.76 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|