C17H26ClN3O2Si — CID 14680648
tert-butyl-[[(2S,5S)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)oxolan-2-yl]methoxy]-dimethylsilane (PubChem CID 14680648) has the molecular formula C17H26ClN3O2Si and a molecular weight of 367.95 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)oxolan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5S)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)oxolan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14680648 |
| Molecular Formula | C17H26ClN3O2Si |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | tert-butyl-[[(2S,5S)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)oxolan-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC[C@@H](n2cnc3ccnc(Cl)c32)O1 |
| InChI | InChI=1S/C17H26ClN3O2Si/c1-17(2,3)24(4,5)22-10-12-6-7-14(23-12)21-11-20-13-8-9-19-16(18)15(13)21/h8-9,11-12,14H,6-7,10H2,1-5H3/t12-,14-/m0/s1 |
| InChIKey | AYNPSPNXKRBKJT-JSGCOSHPSA-N |
| XLogP | 4.78 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|