C19H30N2O4Si — CID 10738453
ethyl 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-cyanopyrrole-2-carboxylate (PubChem CID 10738453) has the molecular formula C19H30N2O4Si and a molecular weight of 378.55 g/mol. Its IUPAC name is ethyl 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-cyanopyrrole-2-carboxylate.
| Compound Name | ethyl 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10738453 |
| Molecular Formula | C19H30N2O4Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-cyanopyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C#N)ccn1[C@H]1CC[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H30N2O4Si/c1-7-23-18(22)17-14(12-20)10-11-21(17)16-9-8-15(25-16)13-24-26(5,6)19(2,3)4/h10-11,15-16H,7-9,13H2,1-6H3/t15-,16+/m0/s1 |
| InChIKey | RVGYUORXGGDNIS-JKSUJKDBSA-N |
| XLogP | 4.24 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|