C19H23N5O3 — CID 173079242
[(5R)-5-[5-cyano-4-(3-methylbut-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl acetate (PubChem CID 173079242) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is [(5R)-5-[5-cyano-4-(3-methylbut-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(5R)-5-[5-cyano-4-(3-methylbut-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 173079242 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [(5R)-5-[5-cyano-4-(3-methylbut-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC[C@H](n2cc(C#N)c3c(NCC=C(C)C)ncnc32)O1 |
| InChI | InChI=1S/C19H23N5O3/c1-12(2)6-7-21-18-17-14(8-20)9-24(19(17)23-11-22-18)16-5-4-15(27-16)10-26-13(3)25/h6,9,11,15-16H,4-5,7,10H2,1-3H3,(H,21,22,23)/t15?,16-/m1/s1 |
| InChIKey | VUFLGKMFXSEXNP-OEMAIJDKSA-N |
| XLogP | 2.92 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|