C10H12N4 — CID 130541128
4-(3-methylbut-2-enylamino)pyrimidine-5-carbonitrile (PubChem CID 130541128) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-(3-methylbut-2-enylamino)pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-methylbut-2-enylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 130541128 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-(3-methylbut-2-enylamino)pyrimidine-5-carbonitrile |
| SMILES | CC(C)=CCNc1ncncc1C#N |
| InChI | InChI=1S/C10H12N4/c1-8(2)3-4-13-10-9(5-11)6-12-7-14-10/h3,6-7H,4H2,1-2H3,(H,12,13,14) |
| InChIKey | BEKRJXBSQDBFSY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|