C9H13ClN4 — CID 106182395
2-chloro-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine (PubChem CID 106182395) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-chloro-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 106182395 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-chloro-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine |
| SMILES | CC(C)=CCNc1nc(Cl)ncc1N |
| InChI | InChI=1S/C9H13ClN4/c1-6(2)3-4-12-8-7(11)5-13-9(10)14-8/h3,5H,4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | JPRXUAONKZOUBX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|