C10H18ClN5O — CID 114126982
2-chloro-4-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyrimidine-4,5-diamine (PubChem CID 114126982) has the molecular formula C10H18ClN5O and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-chloro-4-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 114126982 |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-chloro-4-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyrimidine-4,5-diamine |
| SMILES | CN(C)CCOCCNc1nc(Cl)ncc1N |
| InChI | InChI=1S/C10H18ClN5O/c1-16(2)4-6-17-5-3-13-9-8(12)7-14-10(11)15-9/h7H,3-6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | LMEHWOJLULTGEP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|