C9H14N4 — CID 106198181
2-N-(3-methylbut-2-enyl)pyrazine-2,5-diamine (PubChem CID 106198181) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-N-(3-methylbut-2-enyl)pyrazine-2,5-diamine.
| Compound Name | 2-N-(3-methylbut-2-enyl)pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 106198181 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-N-(3-methylbut-2-enyl)pyrazine-2,5-diamine |
| SMILES | CC(C)=CCNc1cnc(N)cn1 |
| InChI | InChI=1S/C9H14N4/c1-7(2)3-4-11-9-6-12-8(10)5-13-9/h3,5-6H,4H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | NGLGCMBGWMVGLN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|