C19H23ClN4O5 — CID 91131378
[3-butoxy-5-(4-chloro-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]methyl acetate (PubChem CID 91131378) has the molecular formula C19H23ClN4O5 and a molecular weight of 422.87 g/mol. Its IUPAC name is [3-butoxy-5-(4-chloro-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]methyl acetate.
| Compound Name | [3-butoxy-5-(4-chloro-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91131378 |
| Molecular Formula | C19H23ClN4O5 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [3-butoxy-5-(4-chloro-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]methyl acetate |
| SMILES | CCCCOC1C(COC(C)=O)OC(n2cc(C#N)c3c(Cl)ncnc32)C1OC |
| InChI | InChI=1S/C19H23ClN4O5/c1-4-5-6-27-15-13(9-28-11(2)25)29-19(16(15)26-3)24-8-12(7-21)14-17(20)22-10-23-18(14)24/h8,10,13,15-16,19H,4-6,9H2,1-3H3 |
| InChIKey | WVNTYUWJJRXBFU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|