C34H28N6O7 — CID 11227452
[(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 11227452) has the molecular formula C34H28N6O7 and a molecular weight of 632.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11227452 |
| Molecular Formula | C34H28N6O7 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CN(N)c1ncnc2c1c(C#N)cn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H28N6O7/c1-39(36)29-26-24(17-35)18-40(30(26)38-20-37-29)31-28(47-34(43)23-15-9-4-10-16-23)27(46-33(42)22-13-7-3-8-14-22)25(45-31)19-44-32(41)21-11-5-2-6-12-21/h2-16,18,20,25,27-28,31H,19,36H2,1H3/t25-,27-,28-,31-/m1/s1 |
| InChIKey | HUVNVGZXBLWELK-QWOIFIOOSA-N |
| XLogP | 3.82 |
| TPSA | 171.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|