C33H28IN5O7 — CID 59274515
[(2R,4S,5R)-5-[4-[amino(methyl)amino]-5-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 59274515) has the molecular formula C33H28IN5O7 and a molecular weight of 733.52 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[4-[amino(methyl)amino]-5-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S,5R)-5-[4-[amino(methyl)amino]-5-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59274515 |
| Molecular Formula | C33H28IN5O7 |
| Molecular Weight | 733.52 g/mol |
| Exact Mass | 733.10 |
| IUPAC Name | [(2R,4S,5R)-5-[4-[amino(methyl)amino]-5-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CN(N)c1ncnc2c1c(I)cn2[C@@H]1O[C@H](COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H28IN5O7/c1-38(35)28-25-23(34)17-39(29(25)37-19-36-28)30-27(46-33(42)22-15-9-4-10-16-22)26(45-32(41)21-13-7-3-8-14-21)24(44-30)18-43-31(40)20-11-5-2-6-12-20/h2-17,19,24,26-27,30H,18,35H2,1H3/t24-,26?,27+,30-/m1/s1 |
| InChIKey | UEGMVAOGMQZTAN-DHEKLMLGSA-N |
| XLogP | 4.55 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|