C35H29BrN4O7 — CID 162693770
[(2R,3R,4R)-3,4-dibenzoyloxy-5-[5-bromo-4-(prop-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl benzoate (PubChem CID 162693770) has the molecular formula C35H29BrN4O7 and a molecular weight of 697.54 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-5-[5-bromo-4-(prop-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-[5-bromo-4-(prop-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 162693770 |
| Molecular Formula | C35H29BrN4O7 |
| Molecular Weight | 697.54 g/mol |
| Exact Mass | 696.12 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-[5-bromo-4-(prop-2-enylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl benzoate |
| SMILES | C=CCNc1ncnc2c1c(Br)cn2C1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H29BrN4O7/c1-2-18-37-30-27-25(36)19-40(31(27)39-21-38-30)32-29(47-35(43)24-16-10-5-11-17-24)28(46-34(42)23-14-8-4-9-15-23)26(45-32)20-44-33(41)22-12-6-3-7-13-22/h2-17,19,21,26,28-29,32H,1,18,20H2,(H,37,38,39)/t26-,28-,29-,32?/m1/s1 |
| InChIKey | SNZGCZFUDBVEMO-IBTCCFRKSA-N |
| XLogP | 6.00 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|