C33H32ClFN6O12 — CID 135156699
diethyl 2-[[(2R,3S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methoxy]-2-[(4-methoxycarbonylphenyl)methyl]propanedioate (PubChem CID 135156699) has the molecular formula C33H32ClFN6O12 and a molecular weight of 759.10 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methoxy]-2-[(4-methoxycarbonylphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methoxy]-2-[(4-methoxycarbonylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 135156699 |
| Molecular Formula | C33H32ClFN6O12 |
| Molecular Weight | 759.10 g/mol |
| Exact Mass | 758.18 |
| IUPAC Name | diethyl 2-[[(2R,3S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methoxy]-2-[(4-methoxycarbonylphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(C(=O)OC)cc1)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H](F)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OCC |
| InChI | InChI=1S/C33H32ClFN6O12/c1-4-49-30(44)33(31(45)50-5-2,14-17-6-8-18(9-7-17)28(42)48-3)51-15-21-24(53-29(43)19-10-12-20(13-11-19)41(46)47)22(35)27(52-21)40-16-37-23-25(36)38-32(34)39-26(23)40/h6-13,16,21-22,24,27H,4-5,14-15H2,1-3H3,(H2,36,38,39)/t21-,22+,24+,27-/m1/s1 |
| InChIKey | BQEZPJSOFISWKN-SMAWTLEESA-N |
| XLogP | 3.34 |
| TPSA | 236.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.10 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|