C19H24ClFN5O10P — CID 154989218
[(1S)-1-[[(1R,3R,4S,5S)-3-[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 154989218) has the molecular formula C19H24ClFN5O10P and a molecular weight of 567.85 g/mol. Its IUPAC name is [(1S)-1-[[(1R,3R,4S,5S)-3-[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1S)-1-[[(1R,3R,4S,5S)-3-[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 154989218 |
| Molecular Formula | C19H24ClFN5O10P |
| Molecular Weight | 567.85 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | [(1S)-1-[[(1R,3R,4S,5S)-3-[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@@H](OC1[C@H]2O[C@@H](n3cnc4c(NC(=O)OC(C)(C)C)nc(Cl)nc43)[C@@H](F)[C@@]12O)P(=O)(O)O |
| InChI | InChI=1S/C19H24ClFN5O10P/c1-5-33-14(27)15(37(30,31)32)35-10-9-19(10,29)8(21)13(34-9)26-6-22-7-11(23-16(20)25-12(7)26)24-17(28)36-18(2,3)4/h6,8-10,13,15,29H,5H2,1-4H3,(H2,30,31,32)(H,23,24,25,28)/t8-,9-,10?,13-,15+,19+/m1/s1 |
| InChIKey | IJJFODHWBHKHLN-WATJLXTOSA-N |
| XLogP | 1.26 |
| TPSA | 204.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.85 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|