C25H36ClN8O5P — CID 143327826
cyclopropyl 3-[[[4-[2-amino-6-[amino(methyl)amino]purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]butanoate (PubChem CID 143327826) has the molecular formula C25H36ClN8O5P and a molecular weight of 595.04 g/mol. Its IUPAC name is cyclopropyl 3-[[[4-[2-amino-6-[amino(methyl)amino]purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]butanoate.
| Compound Name | cyclopropyl 3-[[[4-[2-amino-6-[amino(methyl)amino]purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]butanoate |
|---|---|
| PubChem CID | 143327826 |
| Molecular Formula | C25H36ClN8O5P |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | cyclopropyl 3-[[[4-[2-amino-6-[amino(methyl)amino]purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]butanoate |
| SMILES | COC(COP(NC(C)CC(=O)OC1CC1)Oc1ccc(Cl)cc1)CC(C)n1cnc2c(N(C)N)nc(N)nc21 |
| InChI | InChI=1S/C25H36ClN8O5P/c1-15(11-21(35)38-18-9-10-18)32-40(39-19-7-5-17(26)6-8-19)37-13-20(36-4)12-16(2)34-14-29-22-23(33(3)28)30-25(27)31-24(22)34/h5-8,14-16,18,20,32H,9-13,28H2,1-4H3,(H2,27,30,31) |
| InChIKey | UABQTRFDFYKDQX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|