C18H27N5O6 — CID 142302789
dimethyl 2-[4-(6-amino-2-methylpurin-9-yl)-2-methoxypentoxy]butanedioate (PubChem CID 142302789) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is dimethyl 2-[4-(6-amino-2-methylpurin-9-yl)-2-methoxypentoxy]butanedioate.
| Compound Name | dimethyl 2-[4-(6-amino-2-methylpurin-9-yl)-2-methoxypentoxy]butanedioate |
|---|---|
| PubChem CID | 142302789 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | dimethyl 2-[4-(6-amino-2-methylpurin-9-yl)-2-methoxypentoxy]butanedioate |
| SMILES | COC(=O)CC(OCC(CC(C)n1cnc2c(N)nc(C)nc21)OC)C(=O)OC |
| InChI | InChI=1S/C18H27N5O6/c1-10(23-9-20-15-16(19)21-11(2)22-17(15)23)6-12(26-3)8-29-13(18(25)28-5)7-14(24)27-4/h9-10,12-13H,6-8H2,1-5H3,(H2,19,21,22) |
| InChIKey | IPQHMQVUKSHGPZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |