C23H34ClN8O5PS — CID 143327511
methyl 2-[[[4-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]-2-methylpropanoate (PubChem CID 143327511) has the molecular formula C23H34ClN8O5PS and a molecular weight of 601.07 g/mol. Its IUPAC name is methyl 2-[[[4-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[[4-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 143327511 |
| Molecular Formula | C23H34ClN8O5PS |
| Molecular Weight | 601.07 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | methyl 2-[[[4-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-2-methoxypentoxy]-(4-chlorophenoxy)phosphanyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NP(OCC(CC(C)n1cnc2c(NNSC)nc(N)nc21)OC)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H34ClN8O5PS/c1-14(32-13-26-18-19(29-31-39-6)27-22(25)28-20(18)32)11-17(34-4)12-36-38(30-23(2,3)21(33)35-5)37-16-9-7-15(24)8-10-16/h7-10,13-14,17,30-31H,11-12H2,1-6H3,(H3,25,27,28,29) |
| InChIKey | XTBAEKNHHAMJBZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 159.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.07 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|