C17H23ClNO5P — CID 134289881
propan-2-yl 2-[[(4-chlorophenoxy)-(2-methoxypent-4-ynoxy)phosphanyl]amino]acetate (PubChem CID 134289881) has the molecular formula C17H23ClNO5P and a molecular weight of 387.80 g/mol. Its IUPAC name is propan-2-yl 2-[[(4-chlorophenoxy)-(2-methoxypent-4-ynoxy)phosphanyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[(4-chlorophenoxy)-(2-methoxypent-4-ynoxy)phosphanyl]amino]acetate |
|---|---|
| PubChem CID | 134289881 |
| Molecular Formula | C17H23ClNO5P |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | propan-2-yl 2-[[(4-chlorophenoxy)-(2-methoxypent-4-ynoxy)phosphanyl]amino]acetate |
| SMILES | C#CCC(COP(NCC(=O)OC(C)C)Oc1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C17H23ClNO5P/c1-5-6-16(21-4)12-22-25(19-11-17(20)23-13(2)3)24-15-9-7-14(18)8-10-15/h1,7-10,13,16,19H,6,11-12H2,2-4H3 |
| InChIKey | MGUZCUWEPRBEAK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|