C13H18Cl2NO3P — CID 130254517
2,2-dimethylpropyl 2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]acetate (PubChem CID 130254517) has the molecular formula C13H18Cl2NO3P and a molecular weight of 338.17 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]acetate |
|---|---|
| PubChem CID | 130254517 |
| Molecular Formula | C13H18Cl2NO3P |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]acetate |
| SMILES | CC(C)(C)COC(=O)CNP(Cl)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18Cl2NO3P/c1-13(2,3)9-18-12(17)8-16-20(15)19-11-6-4-10(14)5-7-11/h4-7,16H,8-9H2,1-3H3 |
| InChIKey | GYPNOFZNJPLZCG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|