C14H20Cl2NO3P — CID 144803948
2,2-dimethylpropyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]propanoate (PubChem CID 144803948) has the molecular formula C14H20Cl2NO3P and a molecular weight of 352.20 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144803948 |
| Molecular Formula | C14H20Cl2NO3P |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphanyl]amino]propanoate |
| SMILES | C[C@H](NP(Cl)Oc1ccc(Cl)cc1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C14H20Cl2NO3P/c1-10(13(18)19-9-14(2,3)4)17-21(16)20-12-7-5-11(15)6-8-12/h5-8,10,17H,9H2,1-4H3/t10-,21?/m0/s1 |
| InChIKey | ZLNFUMAVPMMBRH-LPOBJOOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|