C20H20ClF5NO3P — CID 134290037
butan-2-yl 2-[[(4-chlorophenoxy)-[(2,3,4,5,6-pentafluorophenyl)methyl]phosphanyl]amino]propanoate (PubChem CID 134290037) has the molecular formula C20H20ClF5NO3P and a molecular weight of 483.80 g/mol. Its IUPAC name is butan-2-yl 2-[[(4-chlorophenoxy)-[(2,3,4,5,6-pentafluorophenyl)methyl]phosphanyl]amino]propanoate.
| Compound Name | butan-2-yl 2-[[(4-chlorophenoxy)-[(2,3,4,5,6-pentafluorophenyl)methyl]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 134290037 |
| Molecular Formula | C20H20ClF5NO3P |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | butan-2-yl 2-[[(4-chlorophenoxy)-[(2,3,4,5,6-pentafluorophenyl)methyl]phosphanyl]amino]propanoate |
| SMILES | CCC(C)OC(=O)C(C)NP(Cc1c(F)c(F)c(F)c(F)c1F)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClF5NO3P/c1-4-10(2)29-20(28)11(3)27-31(30-13-7-5-12(21)6-8-13)9-14-15(22)17(24)19(26)18(25)16(14)23/h5-8,10-11,27H,4,9H2,1-3H3 |
| InChIKey | YLKJSKYGGIWBCC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|