C16H12BrF5NO4P — CID 171628819
methyl 2-[[(4-bromophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]propanoate (PubChem CID 171628819) has the molecular formula C16H12BrF5NO4P and a molecular weight of 488.14 g/mol. Its IUPAC name is methyl 2-[[(4-bromophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]propanoate.
| Compound Name | methyl 2-[[(4-bromophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 171628819 |
| Molecular Formula | C16H12BrF5NO4P |
| Molecular Weight | 488.14 g/mol |
| Exact Mass | 486.96 |
| IUPAC Name | methyl 2-[[(4-bromophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(Oc1ccc(Br)cc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H12BrF5NO4P/c1-7(16(24)25-2)23-28(26-9-5-3-8(17)4-6-9)27-15-13(21)11(19)10(18)12(20)14(15)22/h3-7,23H,1-2H3 |
| InChIKey | YPBFQUFGMKRVFX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|