About methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate
methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate (PubChem CID 144654245) has the molecular formula C18H25ClNO3P
and a molecular weight of 369.83 g/mol. Its IUPAC name is methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate.
Molecular Properties
| Compound Name | methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate |
| PubChem CID | 144654245 |
| Molecular Formula | C18H25ClNO3P |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate |
| SMILES | C.CC(C)COC(=O)C(C)NP(Cl)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C17H21ClNO3P.CH4/c1-12(2)11-21-17(20)13(3)19-23(18)22-16-10-6-8-14-7-4-5-9-15(14)16;/h4-10,12-13,19H,11H2,1-3H3;1H4 |
| InChIKey | IJRXZXCLLNNLCN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate?
The IUPAC name of methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate (CID 144654245) is methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate.
What is the SMILES notation for methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate?
The canonical SMILES for methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate is C.CC(C)COC(=O)C(C)NP(Cl)Oc1cccc2ccccc12.
What is the InChIKey of methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate?
The InChIKey is IJRXZXCLLNNLCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClNO3P.CH4/c1-12(2)11-21-17(20)13(3)19-23(18)22-16-10-6-8-14-7-4-5-9-15(14)16;/h4-10,12-13,19H,11H2,1-3H3;1H4.
What are the key properties of methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate?
methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate has a molecular weight of 369.83 g/mol, XLogP of 5.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpropyl 2-[[chloro(naphthalen-1-yloxy)phosphanyl]amino]propanoate is sourced from PubChem (CID 144654245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).