C17H21ClNO4P — CID 59483399
butyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate (PubChem CID 59483399) has the molecular formula C17H21ClNO4P and a molecular weight of 369.79 g/mol. Its IUPAC name is butyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59483399 |
| Molecular Formula | C17H21ClNO4P |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | butyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(Cl)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C17H21ClNO4P/c1-3-4-12-22-17(20)13(2)19-24(18,21)23-16-11-7-9-14-8-5-6-10-15(14)16/h5-11,13H,3-4,12H2,1-2H3,(H,19,21)/t13-,24?/m0/s1 |
| InChIKey | ZCYDLWZWSYHRGF-LNHXHEARSA-N |
| XLogP | 4.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|