C19H26NO4P — CID 122532077
2,2-dimethylpropyl (2R)-2-[[methyl(naphthalen-1-yloxy)phosphoryl]amino]propanoate (PubChem CID 122532077) has the molecular formula C19H26NO4P and a molecular weight of 363.39 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R)-2-[[methyl(naphthalen-1-yloxy)phosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2R)-2-[[methyl(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122532077 |
| Molecular Formula | C19H26NO4P |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2,2-dimethylpropyl (2R)-2-[[methyl(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
| SMILES | C[C@@H](NP(C)(=O)Oc1cccc2ccccc12)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C19H26NO4P/c1-14(18(21)23-13-19(2,3)4)20-25(5,22)24-17-12-8-10-15-9-6-7-11-16(15)17/h6-12,14H,13H2,1-5H3,(H,20,22)/t14-,25?/m1/s1 |
| InChIKey | NMZBLDFYESIQSK-SUUGVPPDSA-N |
| XLogP | 4.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|