C22H32NO3PS — CID 122527458
2,2-dimethylpropyl (2S)-2-[[tert-butyl(naphthalen-1-yloxy)phosphinothioyl]amino]propanoate (PubChem CID 122527458) has the molecular formula C22H32NO3PS and a molecular weight of 421.54 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[tert-butyl(naphthalen-1-yloxy)phosphinothioyl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[tert-butyl(naphthalen-1-yloxy)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 122527458 |
| Molecular Formula | C22H32NO3PS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[tert-butyl(naphthalen-1-yloxy)phosphinothioyl]amino]propanoate |
| SMILES | C[C@H](NP(=S)(Oc1cccc2ccccc12)C(C)(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C22H32NO3PS/c1-16(20(24)25-15-21(2,3)4)23-27(28,22(5,6)7)26-19-14-10-12-17-11-8-9-13-18(17)19/h8-14,16H,15H2,1-7H3,(H,23,28)/t16-,27?/m0/s1 |
| InChIKey | QXQIWQVUKCNKGZ-CJKOFORZSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|