C18H24NO5P — CID 90050405
N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]-naphthalen-2-yloxyphosphonamidic acid (PubChem CID 90050405) has the molecular formula C18H24NO5P and a molecular weight of 365.37 g/mol. Its IUPAC name is N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]-naphthalen-2-yloxyphosphonamidic acid.
| Compound Name | N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]-naphthalen-2-yloxyphosphonamidic acid |
|---|---|
| PubChem CID | 90050405 |
| Molecular Formula | C18H24NO5P |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]-naphthalen-2-yloxyphosphonamidic acid |
| SMILES | C[C@H](NP(=O)(O)Oc1ccc2ccccc2c1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H24NO5P/c1-13(17(20)23-12-18(2,3)4)19-25(21,22)24-16-10-9-14-7-5-6-8-15(14)11-16/h5-11,13H,12H2,1-4H3,(H2,19,21,22)/t13-/m0/s1 |
| InChIKey | QDWAPAKSIAVMPR-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|