C18H24N2O2 — CID 119605476
N-(1-amino-2,3-dimethylbutan-2-yl)-2-naphthalen-2-yloxyacetamide (PubChem CID 119605476) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 119605476 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-naphthalen-2-yloxyacetamide |
| SMILES | CC(C)C(C)(CN)NC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H24N2O2/c1-13(2)18(3,12-19)20-17(21)11-22-16-9-8-14-6-4-5-7-15(14)10-16/h4-10,13H,11-12,19H2,1-3H3,(H,20,21) |
| InChIKey | OUXYGAKKCQONIW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |