C17H22N2O — CID 81486115
N-(1-amino-2,3-dimethylbutan-2-yl)naphthalene-2-carboxamide (PubChem CID 81486115) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 81486115 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)naphthalene-2-carboxamide |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H22N2O/c1-12(2)17(3,11-18)19-16(20)15-9-8-13-6-4-5-7-14(13)10-15/h4-10,12H,11,18H2,1-3H3,(H,19,20) |
| InChIKey | VWYUBVXLWZRLHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |