C13H20ClIN2O — CID 119605904
N-(1-amino-2,3-dimethylbutan-2-yl)-3-iodobenzamide;hydrochloride (PubChem CID 119605904) has the molecular formula C13H20ClIN2O and a molecular weight of 382.67 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-3-iodobenzamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-3-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119605904 |
| Molecular Formula | C13H20ClIN2O |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-3-iodobenzamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1cccc(I)c1.Cl |
| InChI | InChI=1S/C13H19IN2O.ClH/c1-9(2)13(3,8-15)16-12(17)10-5-4-6-11(14)7-10;/h4-7,9H,8,15H2,1-3H3,(H,16,17);1H |
| InChIKey | PYTAOSGIEOYFCD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|