C15H21ClN4O3 — CID 119607727
N-(1-amino-2,3-dimethylbutan-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide;hydrochloride (PubChem CID 119607727) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119607727 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1.Cl |
| InChI | InChI=1S/C15H20N4O3.ClH/c1-8(2)15(3,7-16)19-12(20)9-4-5-10-11(6-9)18-14(22)13(21)17-10;/h4-6,8H,7,16H2,1-3H3,(H,17,21)(H,18,22)(H,19,20);1H |
| InChIKey | ZNCNKPIZHJAKJW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|