C15H20N4O — CID 115310480
N-(1-amino-2,3-dimethylbutan-2-yl)quinoxaline-6-carboxamide (PubChem CID 115310480) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 115310480 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)quinoxaline-6-carboxamide |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C15H20N4O/c1-10(2)15(3,9-16)19-14(20)11-4-5-12-13(8-11)18-7-6-17-12/h4-8,10H,9,16H2,1-3H3,(H,19,20) |
| InChIKey | KIQCRFNTSSCMPG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |