C19H25ClN2O — CID 119608679
N-(1-amino-2,3-dimethylbutan-2-yl)-4-phenylbenzamide;hydrochloride (PubChem CID 119608679) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-phenylbenzamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119608679 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-phenylbenzamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H24N2O.ClH/c1-14(2)19(3,13-20)21-18(22)17-11-9-16(10-12-17)15-7-5-4-6-8-15;/h4-12,14H,13,20H2,1-3H3,(H,21,22);1H |
| InChIKey | WCUFCNQMHRCLAG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |