C14H21ClN2O — CID 112701453
N-(1-amino-2,3-dimethylbutan-2-yl)-4-chloro-3-methylbenzamide (PubChem CID 112701453) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-chloro-3-methylbenzamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-chloro-3-methylbenzamide |
|---|---|
| PubChem CID | 112701453 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-chloro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC(C)(CN)C(C)C)ccc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-9(2)14(4,8-16)17-13(18)11-5-6-12(15)10(3)7-11/h5-7,9H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | HCGSVQOUNRXFLP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |