C18H23NO3 — CID 111483554
N-(2-hydroxy-2,3-dimethylbutyl)-2-naphthalen-2-yloxyacetamide (PubChem CID 111483554) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 111483554 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)-2-naphthalen-2-yloxyacetamide |
| SMILES | CC(C)C(C)(O)CNC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23NO3/c1-13(2)18(3,21)12-19-17(20)11-22-16-9-8-14-6-4-5-7-15(14)10-16/h4-10,13,21H,11-12H2,1-3H3,(H,19,20) |
| InChIKey | NQEFMDBSXMXART-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |