C17H21ClNO5P — CID 87292222
[chloro(naphthalen-1-yloxy)phosphoryl] (2S)-2-[(2-methylpropan-2-yl)oxyamino]propanoate (PubChem CID 87292222) has the molecular formula C17H21ClNO5P and a molecular weight of 385.78 g/mol. Its IUPAC name is [chloro(naphthalen-1-yloxy)phosphoryl] (2S)-2-[(2-methylpropan-2-yl)oxyamino]propanoate.
| Compound Name | [chloro(naphthalen-1-yloxy)phosphoryl] (2S)-2-[(2-methylpropan-2-yl)oxyamino]propanoate |
|---|---|
| PubChem CID | 87292222 |
| Molecular Formula | C17H21ClNO5P |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [chloro(naphthalen-1-yloxy)phosphoryl] (2S)-2-[(2-methylpropan-2-yl)oxyamino]propanoate |
| SMILES | C[C@H](NOC(C)(C)C)C(=O)OP(=O)(Cl)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C17H21ClNO5P/c1-12(19-24-17(2,3)4)16(20)23-25(18,21)22-15-11-7-9-13-8-5-6-10-14(13)15/h5-12,19H,1-4H3/t12-,25?/m0/s1 |
| InChIKey | BPVDPDRMFNHYQA-UNHBDAOFSA-N |
| XLogP | 4.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|